CAS 189625-14-7

1,1-Dimethylethyl N-[(1R,4S)-4-(acetyloxy)-2-cyclopenten-1-yl]carbamate

Description:

1,1-Dimethylethyl N-[(1R,4S)-4-(acetyloxy)-2-cyclopenten-1-yl]carbamate, with the CAS number 189625-14-7, is a chemical compound that belongs to the class of carbamates. This substance features a complex structure characterized by a dimethyl group attached to a tert-butyl group, which contributes to its steric properties. The presence of the cyclopentene ring and an acetyloxy group indicates potential reactivity and biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The compound's specific stereochemistry, denoted by the (1R,4S) configuration, suggests that it may exhibit unique interactions in biological systems, potentially influencing its efficacy and safety profile. Additionally, the carbamate functional group is known for its role in enzyme inhibition and as a building block in the synthesis of more complex molecules. Overall, this compound's characteristics suggest it may have applications in medicinal chemistry or as a pesticide, although further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₂H₁₉NO₄

InChI: InChI=1S/C12H19NO4/c1-8(14)16-10-6-5-9(7-10)13-11(15)17-12(2,3)4/h5-6,9-10H,7H2,1-4H3,(H,13,15)/t9-,10+/m0/s1

InChI key: InChIKey=KSRJRUTXLAQMEK-VHSXEESVSA-N

SMILES: N(C(OC(C)(C)C)=O)[C@@H]1C[C@H](OC(C)=O)C=C1

Synonyms:

• Carbamic acid, [(1R,4S)-4-(acetyloxy)-2-cyclopenten-1-yl]-, 1,1-dimethylethyl ester
• Carbamic acid, [4-(acetyloxy)-2-cyclopenten-1-yl]-, 1,1-dimethylethyl ester, (1R-cis)-
• Carbamic acid, N-[(1R,4S)-4-(acetyloxy)-2-cyclopenten-1-yl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[(1R,4S)-4-(acetyloxy)-2-cyclopenten-1-yl]carbamate