CAS 189639-09-6

9-CYCLOPENTYLADENINE MONOMETHANESULFONATE

Description:

9-Cyclopentyladenine monomethanesulfonate is a synthetic compound that belongs to the class of adenine derivatives, which are nucleobases that play crucial roles in biochemistry, particularly in the structure of nucleic acids. This compound is characterized by the presence of a cyclopentyl group attached to the adenine structure, which can influence its biological activity and receptor binding properties. The monomethanesulfonate salt form enhances its solubility in aqueous solutions, making it suitable for various biological assays and applications. It is often studied for its potential as a plant growth regulator and its effects on cellular signaling pathways. The compound may exhibit specific interactions with adenosine receptors, which are involved in numerous physiological processes. As with many chemical substances, its stability, solubility, and reactivity can be influenced by environmental conditions such as pH and temperature. Safety and handling precautions should be observed, as with any chemical, to mitigate potential hazards during research and application.

Formula: C₁₁H₁₇N₅O₃S

InChI: InChI=1/C10H13N5.CH4O3S/c11-9-8-10(13-5-12-9)15(6-14-8)7-3-1-2-4-7;1-5(2,3)4/h5-7H,1-4H2,(H2,11,12,13);1H3,(H,2,3,4)

SMILES: C1CCC(C1)n1cnc2c(N)ncnc12.CS(=O)(=O)O

9-CP-Ade Mesylate

CAS: 189639-09-6

9-CP-Ade Mesylate

Purity: ≥98%

Molecular weight: 299.35g/mol

Ref: 54-BUP00954

9-Cyclopentyladenine monomethanesulfonate

CAS: 189639-09-6

Formula: C₁₀H₁₃N₅·CH₃SO₃H

Molecular weight: 299.35

Ref: 7W-GK0283

9-CP-Ade Mesylate

CAS: 189639-09-6

9-CP-Ade Mesylate (9 CP Ade Mesylate) is a cell-permeable, stable and non-competitive inhibitor of adenylate cyclase.

Formula: C₁₁H₁₇N₅O₃S

Purity: 99.81%

Color and Shape: Solid

Molecular weight: 299.35

Ref: TM-T23588