CAS 18964-53-9
:2,4,6-Triphenyl-1-hexene
Description:
2,4,6-Triphenyl-1-hexene is an organic compound characterized by its unique structure, which features a hexene backbone with three phenyl groups attached at the 2, 4, and 6 positions. This compound is classified as an alkene due to the presence of a carbon-carbon double bond, which contributes to its reactivity and potential applications in organic synthesis. The presence of multiple phenyl groups enhances its stability and can influence its physical properties, such as solubility and melting point. Typically, compounds like 2,4,6-Triphenyl-1-hexene exhibit interesting optical properties, making them useful in materials science and photonics. Additionally, due to its structural complexity, it may participate in various chemical reactions, including polymerization and cross-coupling reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 2,4,6-Triphenyl-1-hexene is a notable compound in the field of organic chemistry, particularly for its potential applications in advanced materials.
Formula:C24H24
InChI:InChI=1S/C24H24/c1-20(22-13-7-3-8-14-22)19-24(23-15-9-4-10-16-23)18-17-21-11-5-2-6-12-21/h2-16,24H,1,17-19H2
InChI key:InChIKey=VTFWGFWAVPVIAA-UHFFFAOYSA-N
SMILES:C(CC(=C)C1=CC=CC=C1)(CCC2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- 1-Hexene, 2,4,6-triphenyl-
- Benzene, 1,1′,1′′-(1-methylene-1,3,5-pentanetriyl)tris-
- NST 01
- 1,1′,1′′-(1-Methylene-1,3,5-pentanetriyl)tris[benzene]
- 2,4,6-Triphenyl-1-hexene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
