CAS 18967-41-4

2,4-Dichlorobenzyl isothiocyanate

Description:

2,4-Dichlorobenzyl isothiocyanate is an organic compound characterized by its isothiocyanate functional group, which is derived from the reaction of 2,4-dichlorobenzylamine with carbon disulfide. This compound typically appears as a colorless to pale yellow liquid with a pungent odor. It is known for its biological activity, particularly as a potential antimicrobial and antifungal agent. The presence of the isothiocyanate group contributes to its reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. 2,4-Dichlorobenzyl isothiocyanate is soluble in organic solvents but has limited solubility in water. It is important to handle this compound with care due to its potential toxicity and irritant properties. In laboratory settings, it is often used in research related to its biological effects and potential applications in pharmaceuticals or agrochemicals. As with all chemicals, proper safety protocols should be followed when working with this substance.

Formula: C₈H₅Cl₂NS

InChI: InChI=1/C8H5Cl2NS/c9-7-2-1-6(4-11-5-12)8(10)3-7/h1-3H,4H2

SMILES: c1cc(cc(c1CN=C=S)Cl)Cl

2,4-Dichloro-1-(isothiocyanatomethyl)benzene

CAS: 18967-41-4

Formula: C₈H₅Cl₂NS

Molecular weight: 218.1030

Ref: IN-DA002DUS

2,4-Dichlorobenzyl isothiocyanate

CAS: 18967-41-4

Formula: C₈H₅Cl₂NS

Purity: 99.0%

Color and Shape: Liquid

Molecular weight: 218.1

Ref: 10-F018521