CAS 189680-06-6
:2-Bromo-5-hydroxybenzonitrile
Description:
2-Bromo-5-hydroxybenzonitrile is an organic compound characterized by its bromine and hydroxyl functional groups attached to a benzene ring, along with a nitrile group. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity. The hydroxyl group contributes to its potential as a hydrogen bond donor, enhancing solubility in polar solvents. The nitrile group, characterized by the presence of a carbon triple-bonded to nitrogen, imparts significant acidity and can participate in various chemical reactions, including nucleophilic additions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of bromine and the potential toxicity of the nitrile group.
Formula:C7H4BrNO
InChI:InChI=1/C7H4BrNO/c8-7-2-1-6(10)3-5(7)4-9/h1-3,10H
SMILES:c1cc(c(cc1O)C#N)Br
Synonyms:- Benzonitrile, 2-Bromo-5-Hydroxy-
- 2-Bromo-5-hydroxybenzonitrle
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzonitrile, 2-bromo-5-hydroxy-
CAS:Formula:C7H4BrNOPurity:97%Color and Shape:SolidMolecular weight:198.01682-Bromo-5-hydroxybenzonitrile
CAS:2-Bromo-5-hydroxybenzonitrileFormula:C7H4BrNOPurity:97%Color and Shape: brown powderMolecular weight:198.02g/mol2-Bromo-5-hydroxybenzonitrile
CAS:Formula:C7H4BrNOPurity:97%Color and Shape:SolidMolecular weight:198.0192-Bromo-5-hydroxybenzonitrile
CAS:2-Bromo-5-hydroxybenzonitrile is a chemical compound that is used in research and organic synthesis. It can be used to synthesise 2-bromo-5-hydroxybenzoic acid, which has been shown to have anticancer activity.
2-Bromo-5-hydroxylbenzonitrile was synthesized by bromination of 5-hydroxybenzonitrile with NBS. The resulting product was purified by distillation and then recrystallized from ethanol.Formula:C7H4BrNOPurity:Min. 95%Color and Shape:PowderMolecular weight:198.02 g/mol



