CAS 189681-04-7
:4-chloro-5-(2-thienyl)thieno[2,3-d]pyrimidine
Description:
4-Chloro-5-(2-thienyl)thieno[2,3-d]pyrimidine is a heterocyclic compound characterized by its fused thieno and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 4-position and a thienyl group at the 5-position enhances its reactivity and potential biological activity. This compound typically exhibits a planar structure, which can facilitate interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of anti-cancer or anti-inflammatory agents. The compound's solubility, stability, and reactivity can be influenced by the presence of the thienyl group and the chlorine substituent, which may also affect its electronic properties. Additionally, the compound's synthesis and characterization involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to confirm its structure and purity. Overall, 4-chloro-5-(2-thienyl)thieno[2,3-d]pyrimidine represents a significant compound in the field of organic and medicinal chemistry.
Formula:C10H5ClN2S2
InChI:InChI=1/C10H5ClN2S2/c11-9-8-6(7-2-1-3-14-7)4-15-10(8)13-5-12-9/h1-5H
SMILES:c1cc(c2csc3c2c(Cl)ncn3)sc1
Synonyms:- 4-Chloro-5-(Thiophen-2-Yl)Thieno[2,3-D]Pyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Chloro-5-(2-thienyl)thieno[2,3-d]pyrimidine, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H5ClN2S2Purity:97%Color and Shape:White to pale yellow, PowderMolecular weight:252.734-Chloro-5-(2-thienyl)thieno[2,3-d]pyrimidine
CAS:4-Chloro-5-(2-thienyl)thieno[2,3-d]pyrimidinePurity:≥95%Color and Shape:SolidMolecular weight:252.74g/mol4-chloro-5-thien-2-ylthieno[2,3-d]pyrimidine
CAS:Color and Shape:SolidMolecular weight:252.729995727539064-Chloro-5-(2-thienyl)thieno[2,3-d]pyrimidine
CAS:Versatile small molecule scaffold
Formula:C10H5ClN2S2Purity:Min. 95%Molecular weight:252.74 g/mol




