CymitQuimica logo

CAS 1897428-40-8

:

Pyrrolidine, 2,2,4-trimethyl-, hydrochloride (1:1), (4S)-

Description:
Pyrrolidine, 2,2,4-trimethyl-, hydrochloride (1:1), (4S)- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated nitrogen-containing heterocycle. The specific designation "2,2,4-trimethyl" indicates the presence of three methyl groups attached to the pyrrolidine ring, contributing to its steric and electronic properties. The "(4S)" notation refers to the specific stereochemistry at the fourth carbon of the ring, indicating that it has a particular spatial arrangement that can influence its biological activity and interactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceuticals. This compound may exhibit properties relevant to medicinal chemistry, potentially serving as a building block in drug synthesis or as a pharmacologically active agent. Its CAS number, 1897428-40-8, uniquely identifies it in chemical databases, facilitating research and regulatory compliance.
Formula:C7H15N·ClH
InChI:InChI=1S/C7H15N.ClH/c1-6-4-7(2,3)8-5-6;/h6,8H,4-5H2,1-3H3;1H/t6-;/m0./s1
InChI key:InChIKey=HWUWODDRROSFEJ-RGMNGODLSA-N
SMILES:CC1(C)C[C@H](C)CN1.Cl
Synonyms:
  • Pyrrolidine, 2,2,4-trimethyl-, hydrochloride (1:1), (4S)-
  • (4S)-2,2,4-Trimethylpyrrolidine hydrochloride
Found 4 products.