CAS 18977-33-8
:2,6-Bis-(3,4-Dimethoxyphenylmethylene)-Cyclohexanone
Description:
2,6-Bis-(3,4-Dimethoxyphenylmethylene)-Cyclohexanone, with the CAS number 18977-33-8, is an organic compound characterized by its complex structure, which includes a cyclohexanone core substituted with two 3,4-dimethoxyphenylmethylene groups. This compound typically exhibits properties associated with ketones, such as being a yellow to orange solid at room temperature. It is likely to be soluble in organic solvents like ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic aromatic groups. The presence of methoxy groups enhances its electron-donating ability, which can influence its reactivity and interactions in various chemical environments. Additionally, this compound may exhibit interesting optical properties, making it a candidate for applications in organic electronics or as a dye. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be of interest in research related to organic synthesis, materials science, or medicinal chemistry. Safety precautions should be observed when handling this compound, as with all chemical substances.
Formula:C24H26O5
InChI:InChI=1/C24H26O5/c1-26-20-10-8-16(14-22(20)28-3)12-18-6-5-7-19(24(18)25)13-17-9-11-21(27-2)23(15-17)29-4/h8-15H,5-7H2,1-4H3/b18-12+,19-13+
Synonyms:- cyclohexanone, 2,6-bis[(3,4-dimethoxyphenyl)methylene]-, (2E,6E)-
- (2E,6E)-2,6-bis(3,4-dimethoxybenzylidene)cyclohexanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,6-Bis-(3,4-dimethoxyphenylmethylene)cyclohexanone
CAS:Formula:C24H26O5Color and Shape:SolidMolecular weight:394.46022,6-Bis-(3,4-dimethoxyphenylmethylene)cyclohexanone
CAS:Controlled ProductFormula:C24H26O5Color and Shape:NeatMolecular weight:394.46

