CAS 1898-13-1
:CEMBRENE
Description:
Cembreene, with the CAS number 1898-13-1, is a chemical compound classified as a bicyclic monoterpene. It is primarily derived from natural sources, particularly from certain species of plants. Cembreene is characterized by its unique bicyclic structure, which contributes to its distinct physical and chemical properties. Typically, it is a colorless to pale yellow liquid with a characteristic odor. The compound is known for its potential applications in the fragrance industry due to its pleasant scent profile. Additionally, cembreene may exhibit biological activity, which has garnered interest in the fields of pharmacology and natural product chemistry. Its solubility characteristics often allow it to dissolve in organic solvents, making it useful in various formulations. As with many terpenes, cembreene's reactivity can be influenced by environmental factors, and it may participate in various chemical reactions, including oxidation and polymerization. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C20H32
InChI:InChI=1/C20H32/c1-16(2)20-14-12-18(4)10-6-8-17(3)9-7-11-19(5)13-15-20/h8,10-12,14,16,20H,6-7,9,13,15H2,1-5H3/b14-12+,17-8+,18-10-,19-11-/t20-/m0/s1
InChI key:InChIKey=DMHADBQKVWXPPM-PDDCSNRZSA-N
SMILES:C(C)(C)[C@@H]/1CC\C(\C)=C/CC\C(\C)=C\C/C=C(/C)\C=C1
Synonyms:- (1E,3Z,6E,10E,14S)-3,7,11-Trimethyl-14-(1-methylethyl)-1,3,6,10-cyclotetradecatetraene
- (1E,3Z,6E,10Z)-3,7,11-trimethyl-14-(1-methylethyl)cyclotetradeca-1,3,6,10-tetraene
- (1E,3Z,6E,10Z,14S)-3,7,11-trimethyl-14-(1-methylethyl)cyclotetradeca-1,3,6,10-tetraene
- (1S,2E,7E,11E)-2,4(18),7,11-Cembratraene
- (S)-(+)-Cembrene
- 1(S)-Cembrene
- 1,3,6,10-Cyclotetradecatetraene, 14-isopropyl-3,7,11-trimethyl-, (+)-
- 1,3,6,10-Cyclotetradecatetraene, 3,7,11-trimethyl-14-(1-methylethyl)-, (1E,3Z,6E,10E,14S)-
- 1,3,6,10-Cyclotetradecatetraene, 3,7,11-trimethyl-14-(1-methylethyl)-, [S-(E,Z,E,E)]-
- 14-Isopropyl-3,7,11-trimethyl-1,3,6,10-cyclotetradecatetraene
- Thunbergen
- Thunbergene
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(+)-Cembrene
CAS:(+)-Cembrene is a diterpene hydrocarbon, which is a naturally occurring compound primarily found in marine organisms such as soft corals. This compound is characterized by its complex cyclic structure, which is a hallmark of many terpenoids known for diverse biological activities. The source of (+)-Cembrene is often the soft coral species, where it functions as a part of the organism's chemical defense system, deterring predators and inhibiting microbial growth.
Formula:C20H32Purity:Min. 95%Color and Shape:White PowderMolecular weight:272.47 g/mol

