CAS 1899-40-7
:5,6,7,8-Tetrahydro-2,4-quinazolinediamine
Description:
5,6,7,8-Tetrahydro-2,4-quinazolinediamine, with the CAS number 1899-40-7, is a bicyclic organic compound characterized by its quinazoline structure, which consists of a fused benzene and pyrimidine ring. This compound features two amine groups, contributing to its potential as a versatile building block in medicinal chemistry. It is typically a white to off-white solid and is soluble in polar solvents, which enhances its utility in various chemical reactions. The presence of the tetrahydro moiety indicates that it is a saturated derivative, which may influence its reactivity and biological activity. This compound has garnered interest for its potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. Its structural features suggest it may exhibit properties such as antimicrobial or anticancer activity, although specific biological activities would depend on further empirical studies. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C8H12N4
InChI:InChI=1S/C8H12N4/c9-7-5-3-1-2-4-6(5)11-8(10)12-7/h1-4H2,(H4,9,10,11,12)
InChI key:InChIKey=ILYYGQJVLQUTAM-UHFFFAOYSA-N
SMILES:NC1=C2C(=NC(N)=N1)CCCC2
Synonyms:- 2,4-Diamino-5,6,7,8-tetrahydroquinazoline
- 2,4-Quinazolinediamine, 5,6,7,8-tetrahydro-
- 5,6,7,8-Tetrahydro-2,4-quinazolinediamine
- Ai3-50337
- NSC 33682
- Quinazoline, 2,4-diamino-5,6,7,8-tetrahydro-
- 5,6,7,8-Tetrahydroquinazoline-2,4-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,6,7,8-Tetrahydroquinazoline-2,4-diamine
CAS:Formula:C8H12N4Color and Shape:SolidMolecular weight:164.212
