CymitQuimica logo

CAS 190-24-9

:

Hexabenzo[bc,ef,hi,kl,no,qr]coronene

Description:
Hexabenzo[bc,ef,hi,kl,no,qr]coronene is a polycyclic aromatic hydrocarbon (PAH) characterized by its complex structure, which consists of multiple fused benzene rings. This compound is known for its high degree of aromaticity and planar geometry, contributing to its stability and unique electronic properties. It typically exhibits strong fluorescence and can absorb light in the ultraviolet-visible spectrum, making it of interest in various applications, including organic electronics and materials science. Hexabenzo[bc,ef,hi,kl,no,qr]coronene is also notable for its potential environmental implications, as many PAHs are known to be persistent organic pollutants. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as chromatography and spectroscopy. The compound's CAS number, 190-24-9, is a unique identifier that facilitates its identification in chemical databases and literature. Overall, hexabenzo[bc,ef,hi,kl,no,qr]coronene serves as a significant subject of study in both theoretical and applied chemistry due to its intriguing properties and potential uses.
Formula:C42H18
InChI:InChI=1S/C42H18/c1-7-19-21-9-2-11-23-25-13-4-15-27-29-17-6-18-30-28-16-5-14-26-24-12-3-10-22-20(8-1)31(19)37-38(32(21)23)40(34(25)27)42(36(29)30)41(35(26)28)39(37)33(22)24/h1-18H
InChI key:InChIKey=IVJZBYVRLJZOOQ-UHFFFAOYSA-N
SMILES:C12=C3C=4C=5C=6C1=C7C8=C9C6C(C=%10C5C(=C%11C4C(C=%12C3=C(C%13=C2C(C7=CC=C8)=CC=C%13)C=CC%12)=CC=C%11)C=CC%10)=CC=C9
Synonyms:
  • Hexabenzo[bc,ef,hi,kl,no,qr]coronene
  • 1,12;2,3;4,5;6,7;8,9;10,11-Hexabenzocoronene
  • NSC 91579
  • Superbenzene
  • Hexa-peri-benzocoronene
Found 5 products.