CAS 19009-39-3
:N,N-Bis(1-methylethyl)carbamic chloride
Description:
N,N-Bis(1-methylethyl)carbamic chloride, also known by its CAS number 19009-39-3, is a chemical compound characterized by its carbamate functional group. It typically appears as a colorless to pale yellow liquid with a distinctive odor. This compound is known for its reactivity, particularly as a chlorinating agent, which makes it useful in organic synthesis and chemical reactions involving the introduction of chlorine into various substrates. Its structure features two isopropyl groups attached to a central carbamic chloride moiety, contributing to its unique properties. The compound is generally handled with caution due to its potential toxicity and reactivity, necessitating appropriate safety measures during use. It is soluble in organic solvents, which facilitates its application in various chemical processes. As with many carbamates, it may exhibit biological activity, and thus, understanding its environmental and health impacts is essential for safe handling and application in industrial or laboratory settings.
Formula:C7H14ClNO
InChI:InChI=1S/C7H14ClNO/c1-5(2)9(6(3)4)7(8)10/h5-6H,1-4H3
InChI key:InChIKey=RSAFAYLZKCYUQW-UHFFFAOYSA-N
SMILES:N(C(C)C)(C(C)C)C(Cl)=O
Synonyms:- Carbamic chloride, N,N-bis(1-methylethyl)-
- Carbamic chloride, bis(1-methylethyl)-
- Carbamoyl chloride, diisopropyl-
- Diisopropylcarbamic chloride
- Diisopropylcarbamyl chloride
- Dipropan-2-Ylcarbamic Chloride
- N,N-Bis(1-methylethyl)carbamic chloride
- N,N-Diisopropylcarbamoyl chloride
- Diisopropylcarbamoyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Carbamic chloride, N,N-bis(1-methylethyl)-
CAS:Formula:C7H14ClNOPurity:98%Color and Shape:SolidMolecular weight:163.6452N,N-Diisopropylcarbamoyl chloride
CAS:N,N-Diisopropylcarbamoyl chlorideFormula:C7H14ClNOPurity:98%Color and Shape: colourless to off-white crystalline solidMolecular weight:163.65g/molDiisopropylcarbamoyl Chloride
CAS:Formula:C7H14ClNOPurity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:163.65Diisopropylcarbamoyl chloride
CAS:Formula:C7H14ClNOPurity:95%Color and Shape:Solid, Chunks or Crystalline PowderMolecular weight:163.65N,N-Diisopropylcarbamoyl chloride
CAS:N,N-Diisopropylcarbamoyl chloride is a potent antagonist that has been shown to inhibit the thrombin receptor. This drug may be used in the treatment of retinopathies and other conditions that are caused by matrix effects. N,N-Diisopropylcarbamoyl chloride has also been shown to have antidiabetic properties, which may be due to its ability to stabilize glucose levels. It has also been found to be an effective cancer treatment when combined with other drugs during chemotherapy. The carbonyl group in this molecule reacts with amide groups on proteins in a way that inhibits their activity, leading to cancer cell death. N,N-Diisopropylcarbamoyl chloride can be synthesized using asymmetric synthesis and a polymeric matrix.Formula:C7H14ClNOPurity:Min. 95%Color and Shape:PowderMolecular weight:163.64 g/mol




