CAS 190190-48-8

Boc-(R)-3-amino-4-(3-benzothienyl)-butyric acid

Description:

Boc-(R)-3-amino-4-(3-benzothienyl)-butyric acid is a chemical compound characterized by its unique structure, which includes a butyric acid backbone, an amino group, and a benzothienyl substituent. The "Boc" (tert-butyloxycarbonyl) group serves as a protecting group for the amino functionality, making it useful in peptide synthesis and other organic reactions. The compound is typically utilized in medicinal chemistry and drug development due to its potential biological activity. Its chirality, indicated by the (R) configuration, suggests that it may exhibit specific interactions with biological targets, which is crucial for its pharmacological properties. The presence of the benzothienyl moiety may contribute to its lipophilicity and influence its ability to cross biological membranes. Overall, Boc-(R)-3-amino-4-(3-benzothienyl)-butyric acid is a valuable compound in the field of organic synthesis and pharmaceutical research, with applications that may extend to the development of therapeutics targeting various diseases.

Formula: C₁₇H₂₁NO₄S

InChI: InChI=1/C17H21NO4S/c1-17(2,3)22-16(21)18-12(9-15(19)20)8-11-10-23-14-7-5-4-6-13(11)14/h4-7,10,12H,8-9H2,1-3H3,(H,18,21)(H,19,20)/t12-/m1/s1

SMILES: CC(C)(C)OC(=N[C@H](Cc1csc2ccccc12)CC(=O)O)O

Synonyms:

• (3R)-4-(1-benzothiophen-3-yl)-3-[(tert-butoxycarbonyl)amino]butanoic acid
• Boc-D-β-HoAla(3-benzothienyl)-OH

Benzo[b]thiophene-3-butanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-, (βR)-

CAS: 190190-48-8

Formula: C₁₇H₂₁NO₄S

Purity: 98%

Color and Shape: Solid

Molecular weight: 335.4179

Ref: IN-DA002EE2

(R)-4-(Benzo[b]thiophen-3-yl)-3-((tert-butoxycarbonyl)amino)butanoic acid

CAS: 190190-48-8

(R)-4-(Benzo[b]thiophen-3-yl)-3-((tert-butoxycarbonyl)amino)butanoic acid

Purity: 98%

Molecular weight: 335.43g/mol

Ref: 54-OR1061894

Boc-(3-benzothienyl)-D-b-homoalanine

CAS: 190190-48-8

Purity: 99.0%

Molecular weight: 335.4200134277344

Ref: 10-F493406