CAS 190274-01-2: 2-Amino-7-fluoroquinazoline

Description:2-Amino-7-fluoroquinazoline is a heterocyclic organic compound characterized by its quinazoline core, which consists of a fused benzene and pyrimidine ring structure. The presence of an amino group at the 2-position and a fluorine atom at the 7-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents and may show varying degrees of stability depending on environmental conditions such as pH and temperature. It is of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals targeting various diseases. The fluorine atom can enhance the lipophilicity and metabolic stability of the compound, making it a valuable candidate for drug design. Additionally, 2-amino-7-fluoroquinazoline may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are essential for synthesizing more complex molecules. Its specific reactivity and interactions can be influenced by the functional groups present and the overall molecular structure.

Formula:C₈H₆FN₃

InChI:InChI=1/C8H6FN3/c9-6-2-1-5-4-11-8(10)12-7(5)3-6/h1-4H,(H2,10,11,12)

Synonyms:
2-Quinazolinamine,7-fluoro-(9CI)
7-Fluoroquinazolin-2-Amine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-Quinazolinamine, 7-fluoro- REF: IN-DA002EG9CAS: 190274-01-2	- - -	To inquire	Wed 26 Mar 25
7-Fluoro-quinazolin-2-ylamine REF: 54-PC446181CAS: 190274-01-2	95+%	538.00 €	Thu 27 Mar 25
2-Amino-7-fluoroquinazoline REF: 10-F042950CAS: 190274-01-2	95.0%	To inquire	Mon 07 Apr 25
2-Amino-7-fluoroquinazoline REF: 3D-FA43205CAS: 190274-01-2	Min. 95%	- - -	Discontinued product