CAS 190274-15-8

2-Amino-7-bromoquinazoline

Description:

2-Amino-7-bromoquinazoline is a heterocyclic organic compound characterized by its quinazoline core, which consists of a fused benzene and pyrimidine ring system. The presence of an amino group at the 2-position and a bromo substituent at the 7-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents and may have limited solubility in non-polar solvents. It is often used in medicinal chemistry and research due to its potential biological activity, including antitumor and antimicrobial properties. The bromine atom can serve as a useful handle for further chemical modifications, making it a versatile intermediate in organic synthesis. Additionally, 2-amino-7-bromoquinazoline may participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, which are valuable in the development of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper safety protocols are followed.

Formula: C₈H₆BrN₃

InChI: InChI=1/C8H6BrN3/c9-6-2-1-5-4-11-8(10)12-7(5)3-6/h1-4H,(H2,10,11,12)

SMILES: c1cc(cc2c1c[nH]c(=N)n2)Br

Synonyms:

• 2-Quinazolinamine, 7-Bromo-
• 7-Bromoquinazolin-2-amine

2-Quinazolinamine, 7-bromo-

CAS: 190274-15-8

Formula: C₈H₆BrN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 224.0573

Ref: IN-DA002EG7

2-Amino-7-bromoquinazoline

CAS: 190274-15-8

2-Amino-7-bromoquinazoline

Formula: C₈H₆BrN₃

Purity: ≥95%

Color and Shape: yellow solid

Molecular weight: 224.06g/mol

Ref: 54-OR110183

7-Bromoquinazolin-2-amine

CAS: 190274-15-8

Formula: C₈H₆BrN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 224.061

Ref: 10-F321118

2-Amino-7-bromoquinazoline

CAS: 190274-15-8

Versatile small molecule scaffold

Formula: C₈H₆BrN₃

Purity: Min. 95%

Molecular weight: 224.06 g/mol

Ref: 3D-QHA27415