CAS 190383-31-4

PD 168 077 MALEATE

Description:

PD 168 077 Maleate, with the CAS number 190383-31-4, is a chemical compound that belongs to the class of maleate esters. It is primarily recognized for its application in pharmaceutical formulations, particularly as a drug delivery agent or excipient. The compound typically exhibits characteristics such as solubility in organic solvents and limited water solubility, which can influence its behavior in biological systems. PD 168 077 Maleate may also possess specific functional groups that contribute to its reactivity and interaction with other molecules. Its molecular structure allows for potential applications in enhancing the bioavailability of active pharmaceutical ingredients. Additionally, the compound's stability under various conditions is crucial for its effectiveness in formulations. As with many chemical substances, safety data and handling precautions are essential to consider, particularly regarding its potential toxicity and environmental impact. Overall, PD 168 077 Maleate is significant in the context of drug formulation and delivery systems, contributing to advancements in pharmaceutical science.

Formula: C₂₄H₂₆N₄O₅

InChI: InChI=1/C20H22N4O.C4H4O4/c1-16-5-4-7-17(13-16)20(25)22-15-23-9-11-24(12-10-23)19-8-3-2-6-18(19)14-21;5-3(6)1-2-4(7)8/h2-8,13H,9-12,15H2,1H3,(H,22,25);1-2H,(H,5,6)(H,7,8)/b;2-1-

SMILES: Cc1cccc(c1)C(=NCN1CCN(CC1)c1ccccc1C#N)O.C(=C\C(=O)O)\C(=O)O

Synonyms:

• N-[[4-(2-Cyanophenyl)-1-Piperazinyl]Methyl]-3-Methylbenzamide Maleate Salt
• Pd 168,077 Maleate Salt
• N-{[4-(2-cyanophenyl)piperazin-1-yl]methyl}-3-methylbenzamide (2Z)-but-2-enedioate (1:1)

PD 168077 maleate

CAS: 190383-31-4

Formula: C₂₀H₂₂N₄O

Color and Shape: Solid

Molecular weight: 334.4149

Ref: IN-DA002EIY

PD 168,077 maleate salt

CAS: 190383-31-4

Formula: C₂₀H₂₂N₄O·C₄H₄O₄

Molecular weight: 450.49

Ref: 7W-GK8459

PD 168077

Controlled Product

CAS: 190383-31-4

Formula: C₂₀H₂₂N₄O

Color and Shape: Neat

Molecular weight: 334.415

Ref: TR-P218328

PD 168077

CAS: 190383-31-4

PD 168077 is a dopamine uptake inhibitor that is used to study the function of dopamine in the brain. It selectively inhibits the uptake of dopamine into synaptic vesicles and blocks the binding of dopamine to its receptor, leading to an increased amount of dopamine in the synapse. PD 168077 has been shown to be effective against autoimmune diseases such as multiple sclerosis, but also against cancerous cells. Studies have shown that PD 168077 inhibits protein synthesis in tumor cell cultures and inhibits tumor growth in mice.

Formula: C₂₀H₂₂N₄O

Purity: Min. 95%

Molecular weight: 334.41 g/mol

Ref: 3D-QHA38331

PD168,077

CAS: 190383-31-4

PD168,077 is an agonist of dopamine D4 receptor. It has a facilitatory effect on memory consolidation.

Formula: C₂₀H₂₂N₄O

Purity: 98%

Color and Shape: Solid

Molecular weight: 334.41

Ref: TM-T19666