CAS 19041-09-9
:Gluconapin
Description:
Gluconapin, with the CAS number 19041-09-9, is a naturally occurring compound classified as a glucosinolate. It is primarily found in certain cruciferous vegetables, such as mustard and cabbage. Glucosinolates, including gluconapin, are sulfur-containing compounds that play a significant role in plant defense mechanisms and can contribute to the characteristic flavors and aromas of these vegetables. When glucosinolates are hydrolyzed by the enzyme myrosinase, they can produce various bioactive compounds, including isothiocyanates, which are known for their potential health benefits, including anti-cancer properties. Gluconapin is particularly noted for its role in the plant's response to stress and herbivory. In terms of its chemical structure, gluconapin consists of a glucose moiety linked to a sulfur-containing group, which is typical of glucosinolates. Its presence in the diet is associated with various health benefits, although further research is needed to fully understand its biological effects and potential applications in nutrition and medicine.
Formula:C11H19NO9S2
InChI:InChI=1/C11H19NO9S2/c1-2-3-4-7(12-21-23(17,18)19)22-11-10(16)9(15)8(14)6(5-13)20-11/h2,6,8-11,13-16H,1,3-5H2,(H,17,18,19)/p-1/t6-,8-,9+,10-,11+/m1/s1
InChI key:InChIKey=PLYQBXHVYUJNQB-ZHVGPZTNSA-N
SMILES:S(C(=NOS(=O)(=O)O)CCC=C)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
Synonyms:- 4-Isothiocyanato-1-butene glucosinolate
- 3-Butenyl isothiocyanate glucosinolate
- Gluconapin
- β-D-Glucopyranose, 1-thio-, 1-[N-(sulfooxy)-4-pentenimidate]
- Glucopyranose, 1-thio-, 1-(4-pentenohydroximate) NO-(hydrogen sulfate), β-D-
- 1-S-[(1E)-N-(sulfonatooxy)pent-4-enimidoyl]-1-thio-beta-D-glucopyranose
- 1-Thio-beta-D-glucopyranose 1-(N-(sulfooxy)-4-pentenimidate)
- beta-D-Glucopyranose, 1-thio-, 1-(N-(sulfooxy)-4-pentenimidate)
- 3-BUTENYLGLUCOSINOLATE
- GLUCONAPIN(RG)
- gluconapin(1-)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Gluconapin
CAS:Gluconapin serves as a precursor to sulforaphane, an effective anticancer isothiocyanate. It has been found to reduce the increase in plasma triglycerides induced by corn oil consumption in mice.Formula:C11H19NO9S2Color and Shape:SolidMolecular weight:373.4
