CAS 190448-46-5
:2-Azetidinone, 3-[(3S)-3-(acetyloxy)-3-(4-fluorophenyl)propyl]-1-(4-fluorophenyl)-4-(4-hydroxyphenyl)-, (3R,4S)-
Description:
2-Azetidinone, 3-[(3S)-3-(acetyloxy)-3-(4-fluorophenyl)propyl]-1-(4-fluorophenyl)-4-(4-hydroxyphenyl)-, (3R,4S)- is a chemical compound characterized by its azetidinone core structure, which is a four-membered lactam. This compound features multiple functional groups, including an acetyloxy group and fluorophenyl substituents, which contribute to its potential biological activity. The presence of the hydroxyphenyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The stereochemistry indicated by the (3R,4S) configuration is crucial for its biological interactions, as the spatial arrangement of atoms can significantly affect the compound's pharmacological properties. Additionally, the fluorine atoms in the structure may enhance lipophilicity and metabolic stability. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways.
Formula:C26H23F2NO4
InChI:InChI=1/C26H23F2NO4/c1-16(30)33-24(17-2-6-19(27)7-3-17)15-14-23-25(18-4-12-22(31)13-5-18)29(26(23)32)21-10-8-20(28)9-11-21/h2-13,23-25,31H,14-15H2,1H3/t23-,24+,25-/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
3-O-Acetyl Ezetimibe
CAS:Formula:C26H23F2NO4Color and Shape:White To Off-White SolidMolecular weight:451.47(3R,4S)-3-[(3S)-3-(Acetyloxy)-3-(4-fluorophenyl)propyl]-1-(4-fluorophenyl)-4-(4-hydroxyphenyl)-2-azetidinone
CAS:Controlled ProductFormula:C26H23F2NO4Color and Shape:Neat



