CAS 19047-31-5
:N1-CYCLOPROPYL-2-CHLOROACETAMIDE
Description:
N1-Cyclopropyl-2-chloroacetamide is an organic compound characterized by its cyclopropyl group and a chloroacetamide functional group. It features a cyclopropyl ring, which is a three-membered carbon ring known for its unique strain and reactivity. The presence of the chloroacetamide moiety indicates that it contains both a chlorine atom and an amide functional group, which can influence its chemical reactivity and biological activity. This compound is typically used in synthetic organic chemistry and may serve as an intermediate in the synthesis of various pharmaceuticals or agrochemicals. Its properties, such as solubility, boiling point, and stability, can vary based on the specific conditions and solvents used. Additionally, due to the presence of the chlorine atom, it may exhibit specific reactivity patterns, such as nucleophilic substitution. Safety and handling precautions are essential when working with this compound, as it may pose health risks typical of halogenated organic compounds. Overall, N1-cyclopropyl-2-chloroacetamide is a notable compound in chemical research and development.
Formula:C5H8ClNO
InChI:InChI=1/C5H8ClNO/c6-3-5(8)7-4-1-2-4/h4H,1-3H2,(H,7,8)
SMILES:C1CC1N=C(CCl)O
Synonyms:- Otava-Bb Bb7020410100
- Akos Ussh-4110472
- Akos Bbs-00006513
- 2-Chloro-N-Cyclopropylacetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Chloro-N-cyclopropylacetamide, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C5H8ClNOPurity:97%Color and Shape:Pale yellow to pale orange, Crystals or powder or crystalline powderMolecular weight:133.58Acetamide, 2-chloro-N-cyclopropyl-
CAS:Formula:C5H8ClNOPurity:95%Color and Shape:SolidMolecular weight:133.5761N1-Cyclopropyl-2-chloroacetamide
CAS:N1-Cyclopropyl-2-chloroacetamidePurity:95%Molecular weight:133.58g/molN1-Cyclopropyl-2-chloroacetamide
CAS:Formula:C5H8ClNOPurity:98%Color and Shape:Solid, CrystallineMolecular weight:133.58



