CAS 19057-67-1
:Prosapogenin A
Description:
Prosapogenin A, with the CAS number 19057-67-1, is a chemical compound that belongs to the class of saponins, which are glycosides derived from plants. It is characterized by its complex structure, typically featuring a steroid or triterpenoid backbone linked to sugar moieties. Prosapogenin A is known for its potential biological activities, including anti-inflammatory and immunomodulatory effects, which have garnered interest in pharmacological research. The compound is often studied for its role in traditional medicine and its potential therapeutic applications. In terms of solubility, saponins like Prosapogenin A are generally amphiphilic, allowing them to interact with both polar and non-polar environments. This property contributes to their ability to form micelles and affect membrane permeability. Additionally, Prosapogenin A may exhibit cytotoxic effects against certain cancer cell lines, making it a candidate for further investigation in cancer research. Overall, its unique structural and functional characteristics make Prosapogenin A a subject of interest in both natural product chemistry and medicinal studies.
Formula:C39H62O12
InChI:InChI=1S/C39H62O12/c1-18-8-13-39(46-17-18)19(2)28-26(51-39)15-25-23-7-6-21-14-22(9-11-37(21,4)24(23)10-12-38(25,28)5)48-36-34(32(44)30(42)27(16-40)49-36)50-35-33(45)31(43)29(41)20(3)47-35/h6,18-20,22-36,40-45H,7-17H2,1-5H3/t18-,19+,20+,22+,23-,24+,25+,26+,27-,28+,29+,30-,31-,32+,33-,34-,35+,36-,37+,38+,39-/m1/s1
InChI key:InChIKey=HDXIQHTUNGFJIC-FOAHKCLGSA-N
SMILES:C[C@@]12[C@@]3([C@](C[C@]1([C@]4([C@](CC2)([C@]5(C)C(=CC4)C[C@@H](O[C@H]6[C@H](O[C@H]7[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O7)[C@@H](O)[C@H](O)[C@@H](CO)O6)CC5)[H])[H])[H])(O[C@@]8([C@H]3C)CC[C@@H](C)CO8)[H])[H]
Synonyms:- (25R)-3Β-(2-O-Α-L-Rhamnopyranosyl-Β-D-Glucopyranosyloxy)Spirosta-5-Ene
- (3β,25R)-Spirost-5-en-3-yl 2-O-(6-deoxy-α-<span class="text-smallcaps">L</smallcap>-mannopyranosyl)-β-<smallcap>D</span>-glucopyranoside
- 17-Deoxyparis VI
- 25(R)-Diosgenin 3-O-α-<span class="text-smallcaps">L</smallcap>-rhamnopyranosyl-(1→2)-β-<smallcap>D</span>-glucopyranoside
- Diosgenin 3-O-α-<span class="text-smallcaps">L</smallcap>-rhamnopyranosyl-(1→2)-β-<smallcap>D</span>-glucopyranoside
- Glucopyranoside, (25R)-spirost-5-en-3β-yl 2-O-(6-deoxy-α-<span class="text-smallcaps">L</smallcap>-mannopyranosyl)-, β-<smallcap>D</span>-
- Lilioglycoside D
- Ophiopogonin C'
- Paris V
- Paris saponin V
- Polyphyllin V
- Progenin III
- Prosapogenin A
- Prosapogenin A of dioscin
- Prosapogenin A, from Dioscoreatokoro
- Prosapogenin D′<sub>1</sub>
- Saponin Ta
- Spiro[8H-naphth[2′,1′:4,5]indeno[2,1-b]furan-8,2′-[2H]pyran], β-<span class="text-smallcaps">D</span>-glucopyranoside deriv.
- Spirost-5-ene, 3β-[[2-O-(6-deoxy-α-<span class="text-smallcaps">L</smallcap>-mannopyranosyl)-β-<smallcap>D</span>-glucopyranosyl]oxy]-, (25R)-
- Spirostan, β-<span class="text-smallcaps">D</span>-glucopyranoside deriv.
- β-<span class="text-smallcaps">D</smallcap>-Glucopyranoside, (3β,25R)-spirost-5-en-3-yl 2-O-(6-deoxy-α-<smallcap>L</span>-mannopyranosyl)-
- Spirostan, β-D-glucopyranoside deriv.
- Spiro[8H-naphth[2′,1′:4,5]indeno[2,1-b]furan-8,2′-[2H]pyran], β-D-glucopyranoside deriv.
- Spirost-5-ene, 3β-[[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-, (25R)-
- β-D-Glucopyranoside, (3β,25R)-spirost-5-en-3-yl 2-O-(6-deoxy-α-L-mannopyranosyl)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(25R)-3β-(2-O-α-L-Rhamnopyranosyl-β-D-glucopyranosyloxy)spirosta-5-ene
CAS:Formula:C39H62O12Purity:98%Color and Shape:SolidMolecular weight:722.9024Prosapogenin A
CAS:Prosapogenin A (Progenin III) has anticancer activity.Formula:C39H62O12Purity:99.60% - 99.75%Color and Shape:SolidMolecular weight:722.90Ref: TM-T5S1252
1mg46.00€5mg92.00€10mg152.00€25mg250.00€50mg371.00€100mg530.00€1mL*10mM (DMSO)148.00€Prosapogenin a
CAS:Natural glycosideFormula:C39H62O12Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:722.92parissaponinV
CAS:Parisaponin V is a saponin with inhibitory doses in the low micromolar range. It binds to the mitochondrial membrane potential and inhibits the formation of reactive oxygen species, which leads to cell death. Parisaponin V has been shown to have anti-inflammatory and hypoglycemic effects in vitro and in vivo. In a pharmacokinetics study, it was found that parisaponin V is readily absorbed from the gastrointestinal tract, but undergoes extensive first-pass metabolism by cytochrome P450 enzymes. This compound also has an effect on human serum glucose levels, which may be due to its ability to enhance insulin secretion or inhibit gluconeogenesis.
Formula:C39H62O12Purity:Min. 95%Color and Shape:PowderMolecular weight:722.9 g/mol






