CAS 19064-69-8
:1-Phthalazinamine
Description:
1-Phthalazinamine, with the CAS number 19064-69-8, is an organic compound characterized by its phthalazine core, which consists of a fused bicyclic structure containing two nitrogen atoms. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. It exhibits properties such as moderate solubility in organic solvents and may have specific reactivity due to the presence of the amino group, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of nitrogen in the phthalazine ring can also influence its electronic properties, making it a candidate for use in electronic materials or as a ligand in coordination chemistry. Safety data indicates that, like many nitrogen-containing heterocycles, it should be handled with care, as it may pose health risks upon exposure. Overall, 1-Phthalazinamine is a compound of interest for its unique structural features and potential utility in synthetic chemistry.
Formula:C8H7N3
InChI:InChI=1S/C8H7N3/c9-8-7-4-2-1-3-6(7)5-10-11-8/h1-5H,(H2,9,11)
InChI key:InChIKey=WTYSCLHDMXBMKM-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=NN1)C=CC=C2
Synonyms:- 1-Phthalazinamine
- Phthalazin-1-Amine
- Phthalazine, 1-amino-
- 1-Aminophthalazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1-Aminophthalazine
CAS:<p>1-Aminophthalazine is a drug that has been used to treat cancer and other diseases. It has the ability to react with nitrogen atoms in the body, which can cause adverse reactions such as psychosis and drug reactions. 1-Aminophthalazine also blocks tyrosine kinases, which are involved in cell growth and differentiation. 1-Aminophthalazine is a reactive compound that can form diazonium salts with an oxidizing agent such as hydrogen peroxide or peracetic acid. The diazonium salt is then able to react with DNA, and is selective for bacterial DNA when it lacks organic material for the diazonium salt to react with. This makes 1-aminophthalazine a specific treatment for bacterial infections.</p>Formula:C8H7N3Purity:Min. 95%Color and Shape:PowderMolecular weight:145.16 g/mol
