CAS 19066-24-1
:2-phenyladamantane
Description:
2-Phenyladamantane is an organic compound characterized by its unique structure, which combines the adamantane framework with a phenyl group. This compound features a rigid, cage-like structure typical of adamantane, contributing to its stability and distinctive physical properties. It is a colorless solid at room temperature and is generally insoluble in water but soluble in organic solvents. The presence of the phenyl group introduces aromatic characteristics, which can influence its reactivity and interactions with other molecules. 2-Phenyladamantane has garnered interest in various fields, including materials science and medicinal chemistry, due to its potential applications in drug design and as a building block for more complex organic compounds. Its relatively high melting point and thermal stability make it suitable for use in high-performance materials. Additionally, the compound's unique structure may exhibit interesting electronic properties, making it a subject of study in organic electronics and photonics. Overall, 2-phenyladamantane represents a fascinating intersection of structural rigidity and aromaticity in organic chemistry.
Formula:C16H20
InChI:InChI=1S/C16H20/c1-2-4-13(5-3-1)16-14-7-11-6-12(9-14)10-15(16)8-11/h1-5,11-12,14-16H,6-10H2
SMILES:c1ccc(cc1)C1C2CC3CC(C2)CC1C3
Synonyms:- Tricyclo[3.3.1.1~3,7~]Decane, 2-Phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Phenyladamantane
CAS:2-Phenyladamantane is an organic chemical compound. It is a colorless liquid with a sweet aromatic odor. 2-Phenyladamantane has two isomers, one axial and the other equatorial. The axial isomer is more stable than the equatorial isomer because of steric hindrance in the equatorial position. The resonance structures for the axial configuration are shown on the left and those for the equatorial configuration are shown on the right.Formula:C16H20Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:212.33 g/mol

