CAS 190661-29-1
:(2-Benzyloxyphenyl)boronic acid
Description:
(2-Benzyloxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a benzyloxy group. This compound typically exhibits properties such as being a white to off-white solid at room temperature, with moderate solubility in polar organic solvents like methanol and ethanol, while being less soluble in non-polar solvents. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, it can participate in Suzuki-Miyaura cross-coupling reactions, which are vital for constructing complex organic molecules. The presence of the benzyloxy group can enhance the compound's stability and influence its reactivity. Overall, (2-Benzyloxyphenyl)boronic acid serves as a valuable building block in synthetic organic chemistry due to its unique reactivity and functional versatility.
Formula:C13H13BO3
InChI:InChI=1/C13H13BO3/c15-14(16)12-8-4-5-9-13(12)17-10-11-6-2-1-3-7-11/h1-9,15-16H,10H2
SMILES:c1ccc(cc1)COc1ccccc1B(O)O
Synonyms:- 2-Benzyloxyphenylboronic acid
- 2-Benzyloxybenzeneboronic acid
- 2-Phenylmethoxy Phenylboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Benzyloxybenzeneboronic acid, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C13H13BO3Purity:96%Color and Shape:Crystals or powder or crystalline powder, Pale cream to pale brownMolecular weight:228.05Boronic acid, B-[2-(phenylmethoxy)phenyl]-
CAS:Formula:C13H13BO3Purity:97%Color and Shape:SolidMolecular weight:228.05152-(Benzyloxy)benzeneboronic acid
CAS:2-(Benzyloxy)benzeneboronic acidFormula:C13H13BO3Purity:98%Color and Shape: white solidMolecular weight:228.05g/mol2-Benzyloxyphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C13H13BO3Purity:97.0 to 109.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:228.052-Benzyloxyphenylboronic acid
CAS:Formula:C13H13BO3Purity:97%Color and Shape:SolidMolecular weight:228.05





