CAS 19074-30-7
:2,4-DIETHOXYBENZOIC ACID
Description:
2,4-Diethoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of two ethoxy groups attached to the benzene ring at the 2 and 4 positions relative to the carboxylic acid functional group. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic ethoxy substituents. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. 2,4-Diethoxybenzoic acid can be utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, or other fine chemicals. Its molecular structure contributes to its potential applications in materials science and as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H14O4
InChI:InChI=1/C11H14O4/c1-3-14-8-5-6-9(11(12)13)10(7-8)15-4-2/h5-7H,3-4H2,1-2H3,(H,12,13)
SMILES:CCOc1ccc(c(c1)OCC)C(=O)O
Synonyms:- Rarechem Al Be 0820
- Akos Bbb/295
- Benzoic acid, 2,4-diethoxy-
- 2,4-DIETHOXYBENZOIC ACID
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 2,4-diethoxy-
CAS:Formula:C11H14O4Purity:98%Color and Shape:SolidMolecular weight:210.22652,4-Diethoxybenzoic acid
CAS:2,4-Diethoxybenzoic acid is a chemical compound which is found in the essential oil of the plant Dalbergia sissoo. It has been shown to have anti-inflammatory properties and to be a potential therapeutic agent. 2,4-Diethoxybenzoic acid is an acetylated phenolic compound that is used in the production of heartwood extractions. It can act as a mathematical component and can be used in the synthesis of natural products such as isoflavanones. 2,4-Diethoxybenzoic acid has been shown to have antioxidant properties and to inhibit lipid peroxidation at high concentrations.
Formula:C11H14O4Purity:Min. 95%Molecular weight:210.23 g/molRef: 3D-UAA07430
Discontinued product



