CAS 19075-58-2: 6-Bromobenzo[b]thiophene-2-carboxylic acid
Description:6-Bromobenzo[b]thiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a bromine atom and a carboxylic acid functional group attached to a benzo[b]thiophene ring system. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the presence of the thiophene and benzene rings. The bromine substituent can influence its reactivity and solubility, making it useful in various chemical reactions, including electrophilic substitutions. The carboxylic acid group contributes to its acidity and can participate in hydrogen bonding, affecting its solubility in polar solvents. Additionally, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and material science. Its synthesis and characterization often involve standard organic chemistry techniques, and it can serve as a building block for more complex molecules in research and industrial applications.
Formula:C9H5BrO2S
InChI:InChI=1S/C9H5BrO2S/c10-6-2-1-5-3-8(9(11)12)13-7(5)4-6/h1-4H,(H,11,12)
InChI key:InChIKey=CKBBSFOOIOHLPC-UHFFFAOYSA-N
SMILES:O=C(O)C=1SC=2C=C(Br)C=CC2C1
- Synonyms:
- 6-Bromo-1-Benzothiophene-2-Carboxylic Acid
- 6-Bromobenzo[b]thiophene-2-carboxylic acid
- 6-Bromobenzothiophene-2-carboxylic acid
- Benzo[b]thiophene-2-carboxylic acid, 6-bromo-
- Benzo[b]thiophene-6-carboxylic acid, 2-(bromocarbonyl)-

Benzo[b]thiophene-2-carboxylic acid, 6-bromo-
Ref: IN-DA002ERT
1g | 38.00 € | ||
5g | 69.00 € | ||
25g | 190.00 € | ||
100g | 562.00 € |

6-Bromobenzo[b]thiophene-2-carboxylic acid
Ref: 54-OR14032
1g | 32.00 € | ||
5g | 80.00 € | ||
25g | 255.00 € |

6-Bromobenzo[b]thiophene-2-carboxylic acid
Ref: 10-F217994
1g | To inquire | ||
5g | To inquire | ||
10g | To inquire | ||
25g | To inquire |

6-Bromobenzo[b]thiophene-2-carboxylic acid
Ref: 3D-FB56567
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |