CAS 19075-59-3

7-Bromobenzo[b]thiophene-2-carboxylic acid

Description:

7-Bromobenzo[b]thiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a bromine atom and a carboxylic acid functional group attached to a benzo[b]thiophene ring system. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carboxylic acid group. The bromine substituent can influence the compound's reactivity, making it useful in various synthetic applications, including the development of pharmaceuticals and agrochemicals. The carboxylic acid group contributes to its solubility in polar solvents and can participate in hydrogen bonding, affecting its physical properties. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system of the thiophene and benzene rings, which can be leveraged in materials science and organic electronics. Overall, 7-Bromobenzo[b]thiophene-2-carboxylic acid is a versatile compound with potential applications in various fields of chemistry.

Formula: C₉H₅BrO₂S

InChI: InChI=1S/C9H5BrO2S/c10-6-3-1-2-5-4-7(9(11)12)13-8(5)6/h1-4H,(H,11,12)

InChI key: InChIKey=YYKIKWNYRWUIKB-UHFFFAOYSA-N

SMILES: BrC1=C2C(C=C(C(O)=O)S2)=CC=C1

Synonyms:

• 7-Bromobenzo[B]Thiophene-2-Carboxylic Acid
• 7-Bromobenzothiophene-2-carboxylic acid
• Benzo[b]thiophene-2-carboxylic acid, 7-bromo-

7-Bromobenzothiophene-2-carboxylic acid

CAS: 19075-59-3

Formula: C₉H₅BrO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 257.1038

Ref: IN-DA002ERS

7-Bromobenzo[b]thiophene-2-carboxylic acid

CAS: 19075-59-3

7-Bromobenzo[b]thiophene-2-carboxylic acid

Formula: C₉H₅BrO₂S

Purity: 98%

Color and Shape: white solid

Molecular weight: 257.10g/mol

Ref: 54-OR40543

7-Bromobenzo[b]thiophene-2-carboxylic acid

CAS: 19075-59-3

7-Bromobenzo[b]thiophene-2-carboxylic acid is a fine chemical with CAS No. 19075-59-3. It is a useful building block for research chemicals, reagents, and speciality chemicals. It has high quality and can be used as a versatile building block for reactions. 7-Bromobenzo[b]thiophene-2-carboxylic acid can also be used as an intermediate or scaffold in synthesis of complex compounds.

Formula: C₉H₅BrO₂S

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 257.1 g/mol

Ref: 3D-FB139377

7-Bromobenzo[b]thiophene-2-carboxylic acid

CAS: 19075-59-3

Formula: C₉H₅BrO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 257.1

Ref: 10-F231528