CAS 19075-61-7

6-Bromobenzo[b]thiophene-3-carboxylic acid

Description:

6-Bromobenzo[b]thiophene-3-carboxylic acid is an organic compound characterized by its unique structure, which includes a bromine atom and a carboxylic acid functional group attached to a benzo[b]thiophene ring system. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carboxylic acid group. The bromine substituent can influence its electronic properties, making it useful in various chemical reactions, including electrophilic substitutions. The carboxylic acid group contributes to its solubility in polar solvents and can participate in hydrogen bonding, enhancing its reactivity in organic synthesis. Additionally, compounds like 6-Bromobenzo[b]thiophene-3-carboxylic acid are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science due to their interesting chemical behavior and biological activity. Overall, this compound exemplifies the diverse chemistry of substituted thiophenes and their derivatives.

Formula: C₉H₅BrO₂S

InChI: InChI=1S/C9H5BrO2S/c10-5-1-2-6-7(9(11)12)4-13-8(6)3-5/h1-4H,(H,11,12)

InChI key: InChIKey=ZXMDECZLLPFSJO-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(SC1)=CC(Br)=CC2

Synonyms:

• Benzo[b]thiophene-3-carboxylic acid, 6-bromo-
• 6-Bromobenzo[b]thiophene-3-carboxylic acid
• 6-Bromobenzothiophene-3-carboxylic acid

6-Bromobenzo[b]thiophene-3-carboxylic acid

CAS: 19075-61-7

Purity: 98%

Molecular weight: 257.1000061

Ref: 10-F759779