CAS 19075-62-8

7-Bromobenzo[b]thiophene-3-carboxylic acid

Description:

7-Bromobenzo[b]thiophene-3-carboxylic acid is an organic compound characterized by its unique structure, which includes a bromine atom and a carboxylic acid functional group attached to a benzo[b]thiophene ring system. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carboxylic acid group. The bromine substituent can influence its reactivity, making it a useful intermediate in various organic synthesis reactions, including electrophilic substitutions. Additionally, the presence of the carboxylic acid group allows for potential interactions with other molecules, enhancing its solubility in polar solvents. This compound may also exhibit biological activity, making it of interest in medicinal chemistry. Its CAS number, 19075-62-8, is a unique identifier that facilitates its identification in chemical databases and literature. Overall, 7-Bromobenzo[b]thiophene-3-carboxylic acid is a versatile compound with applications in research and development within organic chemistry and related fields.

Formula: C₉H₅BrO₂S

InChI: InChI=1S/C9H5BrO2S/c10-7-3-1-2-5-6(9(11)12)4-13-8(5)7/h1-4H,(H,11,12)

InChI key: InChIKey=LITREOVVQONLSU-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(SC1)=C(Br)C=CC2

Synonyms:

• Benzo[b]thiophene-3-carboxylic acid, 7-bromo-
• 7-Bromobenzo[b]thiophene-3-carboxylic acid

7-Bromo-1-benzothiophene-3-carboxylic acid

CAS: 19075-62-8

Versatile small molecule scaffold

Formula: C₉H₅BrO₂S

Purity: Min. 95%

Molecular weight: 257.11 g/mol

Ref: 3D-UAA07562