CymitQuimica logo

CAS 19076-03-0

:

2-(3-aminophenylsulfonyl)ethanol hydrochloride

Description:
2-(3-Aminophenylsulfonyl)ethanol hydrochloride, with the CAS number 19076-03-0, is a chemical compound characterized by its sulfonamide functional group and an amino group attached to a phenyl ring. This compound typically appears as a white to off-white crystalline solid, which is soluble in water due to the presence of the hydrochloride salt form. The sulfonyl group contributes to its potential as a pharmacological agent, often exhibiting biological activity, including antibacterial or anti-inflammatory properties. The amino group can participate in hydrogen bonding, enhancing its solubility and reactivity. In terms of stability, it is generally stable under standard laboratory conditions but should be stored in a cool, dry place away from strong oxidizing agents. As with many sulfonamides, it may exhibit specific interactions with biological systems, making it of interest in medicinal chemistry. Proper handling and safety precautions are essential, as with all chemical substances, to mitigate any potential hazards during use.
Formula:C8H12ClNO3S
InChI:InChI=1/C8H11NO3S.ClH/c9-7-2-1-3-8(6-7)13(11,12)5-4-10;/h1-3,6,10H,4-5,9H2;1H
SMILES:c1cc(cc(c1)S(=O)(=O)CCO)N.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.