CymitQuimica logo

CAS 19076-79-0

:

2-[4-(2-bromo-1,2-diphenylethenyl)phenoxy]-N,N-dimethylethanamine

Description:
2-[4-(2-bromo-1,2-diphenylethenyl)phenoxy]-N,N-dimethylethanamine, with the CAS number 19076-79-0, is a chemical compound that belongs to the class of organic compounds known as amines. This substance features a complex structure characterized by a diphenylethenyl group, which contributes to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the bromine atom in its structure may impart unique reactivity and properties, making it of interest in synthetic chemistry. Additionally, the dimethylamino group suggests that it may exhibit basic properties, which could influence its solubility and interaction with other chemical species. The phenoxy group enhances its potential for engaging in hydrogen bonding and may affect its biological activity. Overall, this compound's unique structural features may lead to interesting chemical behavior and applications, although specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C24H24BrNO
InChI:InChI=1/C24H24BrNO/c1-26(2)17-18-27-22-15-13-20(14-16-22)23(19-9-5-3-6-10-19)24(25)21-11-7-4-8-12-21/h3-16H,17-18H2,1-2H3
SMILES:CN(C)CCOc1ccc(cc1)C(=C(c1ccccc1)Br)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.