CAS 19077-86-2

1-Benzopyrylium, 3,7-dihydroxy-5-methoxy-2-(3,4,5-trihydroxyphenyl)-, chloride (1:1)

Description:

1-Benzopyrylium, 3,7-dihydroxy-5-methoxy-2-(3,4,5-trihydroxyphenyl)-, chloride (1:1), with CAS number 19077-86-2, is a complex organic compound characterized by its polyphenolic structure. This substance features a benzopyrylium core, which is a fused bicyclic system that includes a pyran ring and a benzene ring, contributing to its aromatic properties. The presence of multiple hydroxyl groups (–OH) indicates that it has significant potential for hydrogen bonding, which can influence its solubility and reactivity. The methoxy group (–OCH3) enhances its lipophilicity, while the trihydroxyphenyl substituent adds to its antioxidant properties. As a chloride salt, it exists in a stable ionic form, which may affect its solubility in various solvents. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in synthesizing other complex organic molecules. Its structural features suggest it may exhibit interesting electronic properties and reactivity patterns, making it a subject of study in organic and medicinal chemistry.

Formula: C₁₆H₁₃O₇·Cl

InChI: InChI=1S/C16H12O7.ClH/c1-22-13-4-8(17)5-14-9(13)6-12(20)16(23-14)7-2-10(18)15(21)11(19)3-7;/h2-6H,1H3,(H4-,17,18,19,20,21);1H

InChI key: InChIKey=YKQDLEVMUBIWQU-UHFFFAOYSA-N

SMILES: O(C)C=1C2=C([O+]=C(C(O)=C2)C3=CC(O)=C(O)C(O)=C3)C=C(O)C1.[Cl-]

Synonyms:

• Pulchelinidol chloride
• 1-Benzopyrylium, 3,7-dihydroxy-5-methoxy-2-(3,4,5-trihydroxyphenyl)-, chloride (1:1)
• 1-Benzopyrylium, 3,7-dihydroxy-5-methoxy-2-(3,4,5-trihydroxyphenyl)-, chloride
• Flavylium, 3,3′,4′,5′,7-pentahydroxy-5-methoxy-, chloride
• Pulchellidin

Pulchellidin

CAS: 19077-86-2

Formula: C₁₆H₁₃O₇·Cl

Molecular weight: 317.27 35.45

Ref: 4Z-P-320001