CAS 190771-22-3
:3-[(TRIMETHYLSILYL)ETHYNYL]BENZONITRILE
Description:
3-[(Trimethylsilyl)ethynyl]benzonitrile is an organic compound characterized by the presence of a benzene ring substituted with a nitrile group and an ethynyl group that is further modified by a trimethylsilyl group. This compound typically exhibits properties associated with both aromatic and alkyne functionalities, contributing to its reactivity and potential applications in organic synthesis. The trimethylsilyl group enhances the stability of the ethynyl moiety, making it less reactive towards nucleophiles while also improving solubility in organic solvents. The nitrile group introduces a polar character, which can influence the compound's interactions in various chemical environments. This compound may be utilized in synthetic organic chemistry, particularly in the development of more complex molecules or materials, due to its ability to participate in cross-coupling reactions and other transformations. Additionally, its unique structural features may allow for specific applications in fields such as materials science or pharmaceuticals, where functionalized aromatic compounds are of interest.
Formula:C12H13NSi
InChI:InChI=1/C12H13NSi/c1-14(2,3)8-7-11-5-4-6-12(9-11)10-13/h4-6,9H,1-3H3
SMILES:C[Si](C)(C)C#Cc1cccc(c1)C#N
Synonyms:- 3-[(Trimethylsilyl)ethynyl]benzonitrile 99%
- 1-(3-Cyanophenyl)-2-(trimethylsilyl)acetylene, 3-[(Trimethylsilanyl)ethynyl]benzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-[(Trimethylsilyl)ethynyl]benzonitrile, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C12H13NSiPurity:97%Molecular weight:199.33Benzonitrile, 3-[2-(trimethylsilyl)ethynyl]-
CAS:Formula:C12H13NSiPurity:97%Molecular weight:199.32383-[(Trimethylsilyl)ethynyl]benzonitrile
CAS:3-[(Trimethylsilyl)ethynyl]benzonitrileFormula:C12H13NSiPurity:99%Color and Shape: white shards crystalline needlesMolecular weight:199.32g/mol



