CAS 190774-47-1: 4-BROMO-2-CHLOROPHENYL ISOCYANATE
Description:4-Bromo-2-chlorophenyl isocyanate is an organic compound characterized by the presence of both bromine and chlorine substituents on a phenyl ring, along with an isocyanate functional group. Its molecular structure features a phenyl ring with a bromine atom at the para position and a chlorine atom at the ortho position relative to the isocyanate group. This compound is typically a pale yellow to brown solid or liquid, depending on its purity and specific conditions. It is known for its reactivity, particularly due to the isocyanate group, which can participate in nucleophilic addition reactions, making it useful in the synthesis of various organic compounds, including pharmaceuticals and agrochemicals. Additionally, 4-bromo-2-chlorophenyl isocyanate may pose health hazards, as isocyanates are generally known to be irritants and sensitizers. Proper handling and safety precautions are essential when working with this compound in laboratory or industrial settings.
Formula:C7H3BrClNO
InChI:InChI=1/C7H3BrClNO/c8-5-1-2-7(10-4-11)6(9)3-5/h1-3H
- Synonyms:
- Benzene, 4-bromo-2-chloro-1-isocyanato- (9CI)
- 4-Bromo-2-Chlorophenyl Isocyanate 97%
- 4-Bromo-2-Chloro-1-Isocyanatobenzene
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 4-Bromo-2-chloro-1-isocyanatobenzene REF: IN-DA002ESLCAS: 190774-47-1 | - - - | To inquire | Tue 12 Aug 25 |
 | 4-Bromo-2-chlorophenyl isocyanate REF: 10-F024226CAS: 190774-47-1 | 95.0% | To inquire | Fri 22 Aug 25 |
 | 4-Bromo-2-chloro-1-isocyanatobenzene REF: 3D-FB114622CAS: 190774-47-1 | Min. 95% | - - - | Discontinued product |
4-Bromo-2-chloro-1-isocyanatobenzene
Ref: IN-DA002ESL
| Undefined size | To inquire |
Ref: 10-F024226
| 1g | To inquire | ||
| 5g | To inquire |
4-Bromo-2-chloro-1-isocyanatobenzene
Ref: 3D-FB114622
| 1g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
