CAS 19078-57-0

4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine

Description:

4,5,6,7-Tetrahydropyrazolo[1,5-a]pyridine is a bicyclic organic compound characterized by its unique pyrazolo and pyridine ring structure. This compound features a saturated pyrazole ring fused to a pyridine ring, resulting in a bicyclic system that contributes to its chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The compound is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. Its structure allows for various functionalization, which can enhance its pharmacological properties. The presence of nitrogen atoms in the rings can influence its reactivity and solubility in different solvents. Additionally, 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine may exhibit interesting interactions with biological targets, which could lead to applications in treating various conditions. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding and other intermolecular interactions, affecting its behavior in chemical reactions and biological systems.

Formula: C₇H₁₀N₂

InChI: InChI=1/C7H10N2/c1-2-6-9-7(3-1)4-5-8-9/h4-5H,1-3,6H2

SMILES: C1CCn2c(C1)ccn2

Synonyms:

• Pyrazolo[1,5-a]pyridine, 4,5,6,7-tetrahydro-
• 4,5,6,7-Tetrahydropyrazolo[1,5-a]pyridine

Pyrazolo[1,5-a]pyridine, 4,5,6,7-tetrahydro-

CAS: 19078-57-0

Formula: C₇H₁₀N₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 122.1677

Ref: IN-DA002ETI

4,5,6,7-Tetrahydropyrazolo[1,5-a]pyridine

CAS: 19078-57-0

4,5,6,7-Tetrahydropyrazolo[1,5-a]pyridine

Purity: 98%

Molecular weight: 122.17g/mol

Ref: 54-OR1036056

4,5,6,7-Tetrahydropyrazolo[1,5-a]pyridine

CAS: 19078-57-0

Purity: 98%

Molecular weight: 122.1709976

Ref: 10-F621937

4H,5H,6H,7H-Pyrazolo[1,5-a]pyridine

CAS: 19078-57-0

This molecule is a synthetic, physicochemical drug that is used to treat women with metastatic breast cancer. It binds to glutamate receptors and blocks the metabotropic glutamate receptor. Pyrazolo[1,5-a]pyridine has been shown to be effective in clinical trials in treating melanotic lesions. The drug has been shown to have a dose-dependent effect on the central nervous system and can lead to death due to cardiac arrest.

Formula: C₇H₁₀N₂

Purity: Min. 95%

Molecular weight: 122.17 g/mol

Ref: 3D-UAA07857