CymitQuimica logo

CAS 190783-99-4

:

1-Methyl-5-oxoproline methyl ester

Description:
1-Methyl-5-oxoproline methyl ester, identified by its CAS number 190783-99-4, is a chemical compound that belongs to the class of proline derivatives. It features a five-membered lactam structure, characterized by the presence of a methyl group at the nitrogen atom and a carbonyl group at the fifth position, contributing to its oxoproline nature. This compound is typically a white to off-white solid and is soluble in organic solvents, which makes it useful in various synthetic applications. Its unique structure allows it to participate in diverse chemical reactions, including those involving nucleophilic attack and cyclization. Additionally, 1-Methyl-5-oxoproline methyl ester may exhibit biological activity, making it of interest in pharmaceutical research. As with many chemical substances, handling should be done with care, adhering to safety protocols to mitigate any potential hazards associated with its use. Overall, this compound serves as a valuable intermediate in organic synthesis and medicinal chemistry.
Formula:C7H11NO3
InChI:InChI=1/C7H11NO3/c1-8-5(7(10)11-2)3-4-6(8)9/h5H,3-4H2,1-2H3/t5-/m0/s1
InChI key:ABAOXDQXQHQRFA-UHFFFAOYSA-N
SMILES:CN1[C@@H](CCC1=O)C(=O)OC
Synonyms:
  • Proline, 1-methyl-5-oxo-, methyl ester
  • Methyl 1-Methyl-5-Oxoprolinate
  • methyl 1-methyl-5-oxo-L-prolinate
Found 4 products.