CymitQuimica logo

CAS 190844-95-2

:

2-[4-[2-[[[(2,4-Difluorophenyl)amino]carbonyl]heptylamino]ethyl]phenoxy]-2-methylbutanoic acid

Description:
The chemical substance known as 2-[4-[2-[[[(2,4-Difluorophenyl)amino]carbonyl]heptylamino]ethyl]phenoxy]-2-methylbutanoic acid, with the CAS number 190844-95-2, is a complex organic compound characterized by its multi-functional structure. It features a phenoxy group, which is indicative of its potential applications in pharmaceuticals or agrochemicals. The presence of a difluorophenyl moiety suggests that it may exhibit unique electronic properties, potentially influencing its reactivity and biological activity. The heptylamino chain contributes to its hydrophobic characteristics, which can affect solubility and permeability in biological systems. Additionally, the carboxylic acid functional group indicates that it can participate in acid-base reactions, making it relevant in various chemical contexts. Overall, this compound's intricate structure may confer specific biological activities, making it a subject of interest in medicinal chemistry and drug development. Its synthesis and characterization would require advanced techniques to confirm its purity and structural integrity.
Formula:C27H36F2N2O4
InChI:InChI=1S/C27H36F2N2O4/c1-4-6-7-8-9-17-31(26(34)30-24-15-12-21(28)19-23(24)29)18-16-20-10-13-22(14-11-20)35-27(3,5-2)25(32)33/h10-15,19H,4-9,16-18H2,1-3H3,(H,30,34)(H,32,33)
InChI key:InChIKey=VGSJXSLGVQINOL-UHFFFAOYSA-N
SMILES:N(C(N(CCC1=CC=C(OC(C(O)=O)(CC)C)C=C1)CCCCCCC)=O)C2=C(F)C=C(F)C=C2
Synonyms:
  • GW 2331
  • Butanoic acid, 2-[4-[2-[[[(2,4-difluorophenyl)amino]carbonyl]heptylamino]ethyl]phenoxy]-2-methyl-
  • 2-[4-[2-[[[(2,4-Difluorophenyl)amino]carbonyl]heptylamino]ethyl]phenoxy]-2-methylbutanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.