CAS 190850-37-4
:2-(4-Chlorobenzoyl)pyridine
Description:
2-(4-Chlorobenzoyl)pyridine, with the CAS number 190850-37-4, is an organic compound characterized by its pyridine and chlorobenzoyl functional groups. It typically appears as a solid or crystalline substance, exhibiting a pale yellow to light brown color. The presence of the chlorobenzoyl moiety contributes to its potential as a versatile building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound is known for its moderate solubility in organic solvents, such as ethanol and acetone, while being less soluble in water due to the hydrophobic nature of the chlorobenzoyl group. Its chemical structure allows for various reactions, including electrophilic substitutions and coupling reactions, making it valuable in synthetic organic chemistry. Additionally, the chlorinated aromatic ring can enhance the compound's biological activity, potentially influencing its interaction with biological targets. Safety data should be consulted for handling and storage, as with many organic compounds, it may pose health risks if not managed properly.
Formula:C12H8ClNO
InChI:InChI=1/C12H8ClNO/c13-10-6-4-9(5-7-10)12(15)11-3-1-2-8-14-11/h1-8H
SMILES:c1ccnc(c1)C(=O)c1ccc(cc1)Cl
Synonyms:- (4-Chlorophenyl)(Pyridin-2-Yl)Methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-(2-Pyridinyl)benzoyl Chloride
CAS:Controlled ProductFormula:C12H8ClNOColor and Shape:NeatMolecular weight:217.651

