CymitQuimica logo

CAS 190850-76-1

:

(2S,3S)-1,4-Dichlorobutane-diol Sulfate

Description:
(2S,3S)-1,4-Dichlorobutane-diol sulfate, identified by its CAS number 190850-76-1, is a chemical compound characterized by its specific stereochemistry and functional groups. This compound features a butane backbone with two chlorine atoms and two hydroxyl (diol) groups, along with a sulfate group, which contributes to its reactivity and solubility in polar solvents. The presence of the sulfate group indicates that it may participate in various biochemical processes, potentially acting as a sulfate donor or participating in sulfation reactions. The stereochemistry, denoted by the (2S,3S) configuration, suggests that the compound has specific three-dimensional orientations that can influence its biological activity and interactions with enzymes or receptors. Such compounds are often studied for their potential applications in pharmaceuticals, biochemistry, and environmental chemistry, particularly in understanding their roles in biological systems or their effects on cellular processes. Overall, the unique combination of functional groups and stereochemistry makes (2S,3S)-1,4-Dichlorobutane-diol sulfate a compound of interest in various scientific fields.
Formula:C4H6Cl2O4S
InChI:InChI=1/C4H6Cl2O4S/c5-1-3-4(2-6)10-11(7,8)9-3/h3-4H,1-2H2/t3-,4-/m1/s1
SMILES:C([C@@H]1[C@@H](CCl)OS(=O)(=O)O1)Cl
Synonyms:
  • (4S,5S)-4,5-Bis(chloromethyl)-1,3,2-dioxathiolane 2,2-dioxide
  • (4S-trans)-4,5-Bis(chloromethyl)-1,3,2-dioxathiolane 2,2-dioxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.