CAS 190895-96-6

3-[(2S)-2-hydroxypropyl]-5-methoxy-2-methylcyclohexa-2,5-diene-1,4-dione

Description:

The chemical substance known as 3-[(2S)-2-hydroxypropyl]-5-methoxy-2-methylcyclohexa-2,5-diene-1,4-dione, with the CAS number 190895-96-6, is a complex organic compound characterized by its unique structural features. It contains a cyclohexadiene core, which is a six-membered ring with alternating double bonds, contributing to its reactivity and stability. The presence of a methoxy group and a hydroxypropyl substituent enhances its solubility and potential for hydrogen bonding, which may influence its biological activity. This compound is likely to exhibit properties typical of diketones, such as reactivity towards nucleophiles and potential applications in organic synthesis or medicinal chemistry. Its stereochemistry, indicated by the (2S) configuration, suggests specific spatial arrangements that could affect its interactions with biological targets. Overall, this compound's structural complexity and functional groups may provide avenues for research in pharmacology or material science, although specific applications would depend on further studies into its properties and behavior in various environments.

Formula: C₁₁H₁₄O₄

InChI: InChI=1/C11H14O4/c1-6(12)4-8-7(2)9(13)5-10(15-3)11(8)14/h5-6,12H,4H2,1-3H3/t6-/m0/s1

Synonyms:

• 3-((2S)-2-Hydroxypropyl)-5-methoxy-2-methylcyclohexa-2,5-diene-1,4-dione

Anserinone B

CAS: 190895-96-6

Anserinone B: Antifungal, antibacterial; inhibits S.fimicola (50%), A. furfuraceus (37%); cytotoxic to human tumor cells (GI50=4.4 µg/mL).

Formula: C₁₁H₁₄O₄

Color and Shape: Solid

Molecular weight: 210.23

Ref: TM-T72963