CAS 19090-04-1
:3-Chromanone
Description:
3-Chromanone, also known as 3-hydroxychroman-4-one, is a chemical compound characterized by its bicyclic structure, which consists of a chroman ring fused with a carbonyl group. It typically appears as a yellow to light brown solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. The compound exhibits a range of interesting chemical properties, including the ability to undergo various reactions such as oxidation and reduction, which can lead to the formation of derivatives with diverse biological activities. 3-Chromanone is of particular interest in medicinal chemistry due to its potential applications in pharmaceuticals, including anti-inflammatory and antioxidant properties. Its structure allows for the possibility of further functionalization, making it a valuable intermediate in organic synthesis. Additionally, it can be used as a building block in the synthesis of more complex molecules, contributing to its relevance in both academic research and industrial applications.
Formula:C9H8O2
InChI:InChI=1/C9H8O2/c10-8-5-7-3-1-2-4-9(7)11-6-8/h1-4H,5-6H2
InChI key:InChIKey=SHHLMGCHMMCOOS-UHFFFAOYSA-N
SMILES:O=C1CC=2C(OC1)=CC=CC2
Synonyms:- 2H-1-benzopyran-3(4H)-one
- 2H-Chromen-3(4H)-one
- 3,4-Dihydro-2H-1-benzopyran-3-one
- 3-Chromanone
- 4h-chromen-3-one
- ChroMan-3-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Chroman-3-one
CAS:<p>Chroman-3-one is a trifluoroacetate ester that has been shown to have anticancer activity. It is an amine that is used in the synthesis of various drugs and pharmaceuticals. Chroman-3-one is also an important precursor in the manufacture of the antidiabetic drug metformin. The compound is often used in organic synthesis because it can be prepared from readily available starting materials, and it can be easily converted to other compounds using a variety of reactions. Chroman-3-one has two tautomeric forms: one where the carbonyl group is protonated and one where the carbonyl group is deprotonated. This means that it can exist as an enantiopure or a mixture of enantiomers.</p>Formula:C9H8O2Purity:Min. 95%Molecular weight:148.16 g/mol
