CAS 1909305-62-9

Ethanesulfonic acid, 2-[(2-thienylcarbonyl)amino]-, sodium salt (1:1)

Description:

Ethanesulfonic acid, 2-[(2-thienylcarbonyl)amino]-, sodium salt (1:1) is a chemical compound characterized by its sulfonic acid functional group and a thienyl moiety, which contributes to its unique properties. As a sodium salt, it is typically soluble in water, making it useful in various aqueous applications. The presence of the thienyl group suggests potential applications in organic synthesis and pharmaceuticals, as thienyl derivatives are often involved in biological activity. The sulfonic acid group enhances the compound's acidity and can facilitate interactions with biological molecules, potentially influencing its reactivity and solubility. This compound may also exhibit specific characteristics such as stability under a range of pH conditions and the ability to form complexes with metal ions. Its molecular structure likely allows for various functionalization possibilities, making it a candidate for further chemical modifications. Overall, the unique combination of functional groups in this compound suggests diverse applications in research and industry, particularly in fields related to medicinal chemistry and materials science.

Formula: C₇H₉NO₄S₂·Na

InChI: InChI=1S/C7H9NO4S2.Na/c9-7(6-2-1-4-13-6)8-3-5-14(10,11)12;/h1-2,4H,3,5H2,(H,8,9)(H,10,11,12);

InChI key: InChIKey=GDUHEUZKNGKIMZ-UHFFFAOYSA-N

SMILES: C(NCCS(=O)(=O)O)(=O)C1=CC=CS1.[Na]

Synonyms:

• Ethanesulfonic acid, 2-[(2-thienylcarbonyl)amino]-, sodium salt (1:1)

Sodium 2-[(thiophen-2-yl)formamido]ethane-1-sulfonate

CAS: 1909305-62-9

Versatile small molecule scaffold

Formula: C₇H₈NNaO₄S₂

Purity: Min. 95%

Molecular weight: 257.3 g/mol

Ref: 3D-JBD30562