CAS 1909305-95-8

Piperidine, 4-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic amine. The presence of a 1,2,4-oxadiazole ring contributes to its unique properties, including potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit properties such as antimicrobial, anti-inflammatory, or analgesic effects, although specific biological activities would depend on further empirical studies. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound represents a blend of piperidine and oxadiazole functionalities, which may offer diverse applications in drug development and research.

Formula: C₁₁H₁₉N₃O·ClH

InChI: InChI=1S/C11H19N3O.ClH/c1-2-3-10-13-11(15-14-10)8-9-4-6-12-7-5-9;/h9,12H,2-8H2,1H3;1H

InChI key: InChIKey=PWYZMHJJUKWJAW-UHFFFAOYSA-N

SMILES: C(C1=NC(CCC)=NO1)C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-[(3-propyl-1,2,4-oxadiazol-5-yl)methyl]-, hydrochloride (1:1)

4-[(3-Propyl-1,2,4-oxadiazol-5-yl)methyl]piperidine hydrochloride

CAS: 1909305-95-8

Versatile small molecule scaffold

Formula: C₁₁H₂₀ClN₃O

Purity: Min. 95%

Molecular weight: 245.75 g/mol

Ref: 3D-JBD30595