CAS 1909305-99-2

1-Butanamine, 3-methyl-3-(methylsulfonyl)-, hydrochloride (1:1)

Description:

1-Butanamine, 3-methyl-3-(methylsulfonyl)-, hydrochloride (1:1), identified by CAS number 1909305-99-2, is an organic compound characterized by its amine functional group and the presence of a methylsulfonyl group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the hydrochloride form, which enhances its solubility compared to the free base. The presence of the butanamine structure suggests it may exhibit basic properties, while the methylsulfonyl group can influence its reactivity and potential biological activity. This compound may be of interest in pharmaceutical research and development, particularly in the context of drug design, due to its structural features that could interact with biological targets. Additionally, the hydrochloride salt form is commonly used to improve stability and bioavailability in medicinal applications. As with many amines, it may also exhibit properties such as hydrogen bonding, which can affect its interactions in various chemical environments.

Formula: C₆H₁₅NO₂S·ClH

InChI: InChI=1S/C6H15NO2S.ClH/c1-6(2,4-5-7)10(3,8)9;/h4-5,7H2,1-3H3;1H

InChI key: InChIKey=JUTAYORUFZAYQN-UHFFFAOYSA-N

SMILES: C(S(C)(=O)=O)(CCN)(C)C.Cl

Synonyms:

• 1-Butanamine, 3-methyl-3-(methylsulfonyl)-, hydrochloride (1:1)

3-Methanesulfonyl-3-methylbutan-1-amine hydrochloride

CAS: 1909305-99-2

Versatile small molecule scaffold

Formula: C₆H₁₆ClNO₂S

Purity: Min. 95%

Molecular weight: 201.72 g/mol

Ref: 3D-JBD30599