CAS 1909306-02-0

Cyclobutanemethanol, 1-[amino(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1)

Description:

Cyclobutanemethanol, 1-[amino(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and a tetrahydro-pyran moiety. This compound features an amino group that is attached to a tetrahydro-2H-pyran, contributing to its potential biological activity. The hydrochloride salt form indicates that it is a protonated version of the base compound, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the amino group suggests potential interactions with biological systems, which may be relevant for drug development. Its molecular structure allows for various stereochemical configurations, which can influence its reactivity and biological properties. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility can vary based on environmental conditions and the presence of other substances. Overall, this compound represents a class of organic molecules with potential applications in medicinal chemistry and related fields.

Formula: C₁₁H₂₁NO₂·ClH

InChI: InChI=1S/C11H21NO2.ClH/c12-10(9-2-6-14-7-3-9)11(8-13)4-1-5-11;/h9-10,13H,1-8,12H2;1H

InChI key: InChIKey=BXXKIJJLPGCMFA-UHFFFAOYSA-N

SMILES: C(N)(C1(CO)CCC1)C2CCOCC2.Cl

Synonyms:

• Cyclobutanemethanol, 1-[amino(tetrahydro-2H-pyran-4-yl)methyl]-, hydrochloride (1:1)

{1-[Amino(oxan-4-yl)methyl]cyclobutyl}methanol hydrochloride

CAS: 1909306-02-0

Versatile small molecule scaffold

Formula: C₁₁H₂₂ClNO₂

Purity: Min. 95%

Molecular weight: 235.75 g/mol

Ref: 3D-JBD30602