CAS 1909310-03-7

Benzenemethanamine, 4-[(1-oxido-4-thiomorpholinyl)methyl]-, hydrochloride (1:2)

Description:

Benzenemethanamine, 4-[(1-oxido-4-thiomorpholinyl)methyl]-, hydrochloride (1:2), identified by CAS number 1909310-03-7, is a chemical compound characterized by its complex structure that includes a benzene ring, an amine group, and a thiomorpholine moiety. This compound typically appears as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The presence of the thiomorpholine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The oxido group indicates the presence of an oxygen atom bonded to the sulfur atom in the thiomorpholine, which may contribute to the compound's reactivity and stability. Overall, this compound's unique structural features may confer specific properties, such as potential therapeutic effects or interactions with various biological systems, making it of interest in research and development within the fields of chemistry and pharmacology.

Formula: C₁₂H₁₈N₂OS·2ClH

InChI: InChI=1S/C12H18N2OS.2ClH/c13-9-11-1-3-12(4-2-11)10-14-5-7-16(15)8-6-14;;/h1-4H,5-10,13H2;2*1H

InChI key: InChIKey=QCMLLUWFPNDYJV-UHFFFAOYSA-N

SMILES: C(C1=CC=C(CN)C=C1)N2CCS(=O)CC2.Cl

Synonyms:

• Benzenemethanamine, 4-[(1-oxido-4-thiomorpholinyl)methyl]-, hydrochloride (1:2)

4-(4-(Aminomethyl)benzyl)thiomorpholine 1-oxide dihydrochloride

CAS: 1909310-03-7

Versatile small molecule scaffold

Formula: C₁₂H₂₀Cl₂N₂OS

Purity: Min. 95%

Molecular weight: 311.3 g/mol

Ref: 3D-JBD31003