CAS 1909310-04-8

Benzenamine, 2-methyl-3-(2-oxazolyl)-, hydrochloride (1:2)

Description:

Benzenamine, 2-methyl-3-(2-oxazolyl)-, hydrochloride (1:2), with the CAS number 1909310-04-8, is a chemical compound characterized by its amine and oxazole functional groups. This substance typically appears as a crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The compound features a benzene ring substituted with a methyl group and an oxazole ring, contributing to its unique chemical properties and potential biological activity. It may exhibit characteristics such as moderate to high stability under standard conditions, but its reactivity can vary depending on the presence of functional groups and environmental factors. As a hydrochloride salt, it is likely to have enhanced stability and ease of handling compared to its non-salt form. This compound may be of interest in pharmaceutical research and development, particularly in the synthesis of biologically active molecules or as a potential therapeutic agent.

Formula: C₁₀H₁₀N₂O·2ClH

InChI: InChI=1S/C10H10N2O.2ClH/c1-7-8(3-2-4-9(7)11)10-12-5-6-13-10;;/h2-6H,11H2,1H3;2*1H

InChI key: InChIKey=TYHFTNLOBBMIQL-UHFFFAOYSA-N

SMILES: CC1=C(C=CC=C1N)C2=NC=CO2.Cl

Synonyms:

• Benzenamine, 2-methyl-3-(2-oxazolyl)-, hydrochloride (1:2)

2-Methyl-3-(1,3-oxazol-2-yl)aniline dihydrochloride

CAS: 1909310-04-8

Versatile small molecule scaffold

Formula: C₁₀H₁₂Cl₂N₂O

Purity: Min. 95%

Molecular weight: 247.12 g/mol

Ref: 3D-JBD31004