CAS 1909316-01-3

1,2-Ethanediamine, N1-cyclopropyl-N2-(phenylmethyl)-, hydrochloride (1:2)

Description:

1,2-Ethanediamine, N1-cyclopropyl-N2-(phenylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its amine functional groups, specifically a diamine structure. It features a cyclopropyl group and a phenylmethyl substituent, which contribute to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the cyclopropyl moiety may influence its pharmacokinetic and pharmacodynamic profiles, potentially affecting its interaction with biological targets. This compound may exhibit characteristics typical of amines, such as basicity and the ability to form hydrogen bonds, which can be significant in drug design and development. Additionally, the specific arrangement of its substituents can lead to interesting stereochemical properties, impacting its reactivity and interaction with other molecules. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and related fields.

Formula: C₁₂H₁₈N₂·2ClH

InChI: InChI=1S/C12H18N2.2ClH/c1-2-4-11(5-3-1)10-13-8-9-14-12-6-7-12;;/h1-5,12-14H,6-10H2;2*1H

InChI key: InChIKey=ZGLICBYMOUGDKW-UHFFFAOYSA-N

SMILES: C(NCCNC1CC1)C2=CC=CC=C2.Cl

Synonyms:

• 1,2-Ethanediamine, N1-cyclopropyl-N2-(phenylmethyl)-, hydrochloride (1:2)

N-[2-(Benzylamino)ethyl]cyclopropanamine dihydrochloride

CAS: 1909316-01-3

Versatile small molecule scaffold

Formula: C₁₂H₂₀Cl₂N₂

Purity: Min. 95%

Molecular weight: 263.2 g/mol

Ref: 3D-JBD31601