CAS 1909317-01-6

Thiazole, 4-(3-methylphenyl)-2-(1H-pyrrol-2-yl)-, hydrobromide (1:1)

Description:

Thiazole, 4-(3-methylphenyl)-2-(1H-pyrrol-2-yl)-, hydrobromide (1:1) is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The compound features a 3-methylphenyl group and a pyrrole moiety, contributing to its unique properties and potential biological activities. As a hydrobromide salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. The presence of the thiazole and pyrrole rings suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may exhibit various functional properties, including antimicrobial or anticancer activities, although specific biological data would depend on empirical studies. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential pharmacological effects.

Formula: C₁₄H₁₂N₂S·BrH

InChI: InChI=1S/C14H12N2S.BrH/c1-10-4-2-5-11(8-10)13-9-17-14(16-13)12-6-3-7-15-12;/h2-9,15H,1H3;1H

InChI key: InChIKey=QZOWTCPESFPVNM-UHFFFAOYSA-N

SMILES: CC=1C=C(C=2N=C(SC2)C3=CC=CN3)C=CC1.Br

Synonyms:

• Thiazole, 4-(3-methylphenyl)-2-(1H-pyrrol-2-yl)-, hydrobromide (1:1)

4-(3-Methylphenyl)-2-(1H-pyrrol-2-yl)-1,3-thiazole hydrobromide

CAS: 1909317-01-6

Versatile small molecule scaffold

Formula: C₁₄H₁₃BrN₂S

Purity: Min. 95%

Molecular weight: 321.24 g/mol

Ref: 3D-JBD31701