CAS 1909318-82-6

4-Iodo-3-isothiazolecarboxylic acid

Description:

4-Iodo-3-isothiazolecarboxylic acid is a heterocyclic compound characterized by the presence of both an isothiazole ring and a carboxylic acid functional group. The isothiazole moiety consists of a five-membered ring containing both sulfur and nitrogen atoms, contributing to its unique chemical properties. The presence of the iodine substituent at the 4-position enhances its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions. This compound is typically used in organic synthesis and may exhibit biological activity, making it of interest in pharmaceutical research. Its carboxylic acid group provides acidic properties, allowing for potential interactions in biological systems or with other chemical entities. Additionally, the compound's solubility and stability can be influenced by the presence of the iodine atom and the isothiazole structure. Overall, 4-Iodo-3-isothiazolecarboxylic acid is a versatile compound with applications in medicinal chemistry and materials science, warranting further exploration of its properties and potential uses.

Formula: C₄H₂INO₂S

InChI: InChI=1S/C4H2INO2S/c5-2-1-9-6-3(2)4(7)8/h1H,(H,7,8)

InChI key: InChIKey=JTLAVUZUYQYSAR-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(I)=CSN1

Synonyms:

• 3-Isothiazolecarboxylic acid, 4-iodo-
• 4-Iodo-3-isothiazolecarboxylic acid

4-Iodo-1,2-thiazole-3-carboxylic acid

CAS: 1909318-82-6

Versatile small molecule scaffold

Formula: C₄H₂INO₂S

Purity: Min. 95%

Molecular weight: 255.04 g/mol

Ref: 3D-JBD31882