CAS 1909319-17-0

1,4-Benzoxathiin-2-methanamine, 2,3-dihydro-, hydrochloride (1:1)

Description:

1,4-Benzoxathiin-2-methanamine, 2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both a benzene ring and a thiazine moiety. This compound features a methanamine functional group, contributing to its potential reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. The presence of the dihydro configuration indicates that the compound may exhibit specific stereochemical properties that can influence its interaction with biological targets. Its CAS number, 1909319-17-0, allows for precise identification in chemical databases. While specific applications may vary, compounds of this nature are often investigated for their potential therapeutic effects, particularly in the fields of medicinal chemistry and drug development. Overall, the characteristics of this compound suggest it may play a role in various chemical and biological processes, warranting further study to elucidate its full potential.

Formula: C₉H₁₁NOS·ClH

InChI: InChI=1S/C9H11NOS.ClH/c10-5-7-6-12-9-4-2-1-3-8(9)11-7;/h1-4,7H,5-6,10H2;1H

InChI key: InChIKey=NSDSKHUUAQAGIS-UHFFFAOYSA-N

SMILES: C(N)C1OC=2C(SC1)=CC=CC2.Cl

Synonyms:

• 1,4-Benzoxathiin-2-methanamine, 2,3-dihydro-, hydrochloride (1:1)

(2,3-Dihydro-1,4-benzoxathiin-2-yl)methanamine hydrochloride

CAS: 1909319-17-0

Versatile small molecule scaffold

Formula: C₉H₁₂ClNOS

Purity: Min. 95%

Molecular weight: 217.72 g/mol

Ref: 3D-JBD31917